About methanol;methyl carbamimidothioate
methanol;methyl carbamimidothioate (PubChem CID 174859349) has the molecular formula C3H10N2OS
and a molecular weight of 122.19 g/mol. Its IUPAC name is methanol;methyl carbamimidothioate.
Molecular Properties
| Compound Name | methanol;methyl carbamimidothioate |
| PubChem CID | 174859349 |
| Molecular Formula | C3H10N2OS |
| Molecular Weight | 122.19 g/mol |
| Exact Mass | 122.05 |
| IUPAC Name | methanol;methyl carbamimidothioate |
| SMILES | CO.[H]/N=C(/N)SC |
| InChI | InChI=1S/C2H6N2S.CH4O/c1-5-2(3)4;1-2/h1H3,(H3,3,4);2H,1H3 |
| InChIKey | ZSOBJHBAQCUQGK-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 70.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.19 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methanol;methyl carbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;methyl carbamimidothioate?
The IUPAC name of methanol;methyl carbamimidothioate (CID 174859349) is methanol;methyl carbamimidothioate.
What is the SMILES notation for methanol;methyl carbamimidothioate?
The canonical SMILES for methanol;methyl carbamimidothioate is CO.[H]/N=C(/N)SC.
What is the InChIKey of methanol;methyl carbamimidothioate?
The InChIKey is ZSOBJHBAQCUQGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6N2S.CH4O/c1-5-2(3)4;1-2/h1H3,(H3,3,4);2H,1H3.
What are the key properties of methanol;methyl carbamimidothioate?
methanol;methyl carbamimidothioate has a molecular weight of 122.19 g/mol, XLogP of -0.15, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;methyl carbamimidothioate is sourced from PubChem (CID 174859349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).