C8H11N5O2S2 — CID 134094475
(4-carbamimidoylsulfanyl-1-ethyl-2,5-dioxopyrrol-3-yl) carbamimidothioate (PubChem CID 134094475) has the molecular formula C8H11N5O2S2 and a molecular weight of 273.34 g/mol. Its IUPAC name is (4-carbamimidoylsulfanyl-1-ethyl-2,5-dioxopyrrol-3-yl) carbamimidothioate.
| Compound Name | (4-carbamimidoylsulfanyl-1-ethyl-2,5-dioxopyrrol-3-yl) carbamimidothioate |
|---|---|
| PubChem CID | 134094475 |
| Molecular Formula | C8H11N5O2S2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | (4-carbamimidoylsulfanyl-1-ethyl-2,5-dioxopyrrol-3-yl) carbamimidothioate |
| SMILES | [H]/N=C(\N)SC1=C(S/C(N)=N/[H])C(=O)N(CC)C1=O |
| InChI | InChI=1S/C8H11N5O2S2/c1-2-13-5(14)3(16-7(9)10)4(6(13)15)17-8(11)12/h2H2,1H3,(H3,9,10)(H3,11,12) |
| InChIKey | VIFVJQNHLHYKLT-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 137.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|