C7H9N5O2S2 — CID 87399267
(4-carbamimidoyl-1-methyl-2,5-dioxopyrrol-3-yl)sulfanyl carbamimidothioate (PubChem CID 87399267) has the molecular formula C7H9N5O2S2 and a molecular weight of 259.32 g/mol. Its IUPAC name is (4-carbamimidoyl-1-methyl-2,5-dioxopyrrol-3-yl)sulfanyl carbamimidothioate.
| Compound Name | (4-carbamimidoyl-1-methyl-2,5-dioxopyrrol-3-yl)sulfanyl carbamimidothioate |
|---|---|
| PubChem CID | 87399267 |
| Molecular Formula | C7H9N5O2S2 |
| Molecular Weight | 259.32 g/mol |
| Exact Mass | 259.02 |
| IUPAC Name | (4-carbamimidoyl-1-methyl-2,5-dioxopyrrol-3-yl)sulfanyl carbamimidothioate |
| SMILES | [H]/N=C(\N)C1=C(SS/C(N)=N/[H])C(=O)N(C)C1=O |
| InChI | InChI=1S/C7H9N5O2S2/c1-12-5(13)2(4(8)9)3(6(12)14)15-16-7(10)11/h1H3,(H3,8,9)(H3,10,11) |
| InChIKey | HFFSAJTXLARAPQ-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 137.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.32 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|