C8H8N2O2S2 — CID 129154796
1,3-benzodioxol-5-ylsulfanyl carbamimidothioate (PubChem CID 129154796) has the molecular formula C8H8N2O2S2 and a molecular weight of 228.30 g/mol. Its IUPAC name is 1,3-benzodioxol-5-ylsulfanyl carbamimidothioate.
| Compound Name | 1,3-benzodioxol-5-ylsulfanyl carbamimidothioate |
|---|---|
| PubChem CID | 129154796 |
| Molecular Formula | C8H8N2O2S2 |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.00 |
| IUPAC Name | 1,3-benzodioxol-5-ylsulfanyl carbamimidothioate |
| SMILES | [H]/N=C(\N)SSc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C8H8N2O2S2/c9-8(10)14-13-5-1-2-6-7(3-5)12-4-11-6/h1-3H,4H2,(H3,9,10) |
| InChIKey | OWKOOFMWVYVQTH-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 68.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|