C13H16O4S — CID 117035578
methyl 2-(1,3-benzodioxol-5-ylsulfanyl)-3-methylbutanoate (PubChem CID 117035578) has the molecular formula C13H16O4S and a molecular weight of 268.33 g/mol. Its IUPAC name is methyl 2-(1,3-benzodioxol-5-ylsulfanyl)-3-methylbutanoate.
| Compound Name | methyl 2-(1,3-benzodioxol-5-ylsulfanyl)-3-methylbutanoate |
|---|---|
| PubChem CID | 117035578 |
| Molecular Formula | C13H16O4S |
| Molecular Weight | 268.33 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | methyl 2-(1,3-benzodioxol-5-ylsulfanyl)-3-methylbutanoate |
| SMILES | COC(=O)C(Sc1ccc2c(c1)OCO2)C(C)C |
| InChI | InChI=1S/C13H16O4S/c1-8(2)12(13(14)15-3)18-9-4-5-10-11(6-9)17-7-16-10/h4-6,8,12H,7H2,1-3H3 |
| InChIKey | CAGVSTWETVZBLK-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.33 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |