C18H23NO6S2 — CID 139677510
tert-butyl 2-[[3-acetylsulfanyl-2-(1,3-benzodioxol-5-ylsulfanyl)propanoyl]amino]acetate (PubChem CID 139677510) has the molecular formula C18H23NO6S2 and a molecular weight of 413.52 g/mol. Its IUPAC name is tert-butyl 2-[[3-acetylsulfanyl-2-(1,3-benzodioxol-5-ylsulfanyl)propanoyl]amino]acetate.
| Compound Name | tert-butyl 2-[[3-acetylsulfanyl-2-(1,3-benzodioxol-5-ylsulfanyl)propanoyl]amino]acetate |
|---|---|
| PubChem CID | 139677510 |
| Molecular Formula | C18H23NO6S2 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | tert-butyl 2-[[3-acetylsulfanyl-2-(1,3-benzodioxol-5-ylsulfanyl)propanoyl]amino]acetate |
| SMILES | CC(=O)SCC(Sc1ccc2c(c1)OCO2)C(=O)NCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H23NO6S2/c1-11(20)26-9-15(17(22)19-8-16(21)25-18(2,3)4)27-12-5-6-13-14(7-12)24-10-23-13/h5-7,15H,8-10H2,1-4H3,(H,19,22) |
| InChIKey | YUZLWTCIMWACPK-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|