C19H19NO6S — CID 18968887
dimethyl 2-[(2-aminophenyl)sulfanyl-(1,3-benzodioxol-5-yl)methyl]propanedioate (PubChem CID 18968887) has the molecular formula C19H19NO6S and a molecular weight of 389.43 g/mol. Its IUPAC name is dimethyl 2-[(2-aminophenyl)sulfanyl-(1,3-benzodioxol-5-yl)methyl]propanedioate.
| Compound Name | dimethyl 2-[(2-aminophenyl)sulfanyl-(1,3-benzodioxol-5-yl)methyl]propanedioate |
|---|---|
| PubChem CID | 18968887 |
| Molecular Formula | C19H19NO6S |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | dimethyl 2-[(2-aminophenyl)sulfanyl-(1,3-benzodioxol-5-yl)methyl]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)C(Sc1ccccc1N)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H19NO6S/c1-23-18(21)16(19(22)24-2)17(27-15-6-4-3-5-12(15)20)11-7-8-13-14(9-11)26-10-25-13/h3-9,16-17H,10,20H2,1-2H3 |
| InChIKey | DCEGKGOIWZMGTG-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 97.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|