About [1-(1,3-benzodioxol-5-ylsulfanyl)cyclobutyl]methanol
[1-(1,3-benzodioxol-5-ylsulfanyl)cyclobutyl]methanol (PubChem CID 117035033) has the molecular formula C12H14O3S
and a molecular weight of 238.31 g/mol. Its IUPAC name is [1-(1,3-benzodioxol-5-ylsulfanyl)cyclobutyl]methanol.
Molecular Properties
| Compound Name | [1-(1,3-benzodioxol-5-ylsulfanyl)cyclobutyl]methanol |
| PubChem CID | 117035033 |
| Molecular Formula | C12H14O3S |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | [1-(1,3-benzodioxol-5-ylsulfanyl)cyclobutyl]methanol |
| SMILES | OCC1(Sc2ccc3c(c2)OCO3)CCC1 |
| InChI | InChI=1S/C12H14O3S/c13-7-12(4-1-5-12)16-9-2-3-10-11(6-9)15-8-14-10/h2-3,6,13H,1,4-5,7-8H2 |
| InChIKey | COSJVVRCLLSJEL-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-(1,3-benzodioxol-5-ylsulfanyl)cyclobutyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(1,3-benzodioxol-5-ylsulfanyl)cyclobutyl]methanol?
The IUPAC name of [1-(1,3-benzodioxol-5-ylsulfanyl)cyclobutyl]methanol (CID 117035033) is [1-(1,3-benzodioxol-5-ylsulfanyl)cyclobutyl]methanol.
What is the SMILES notation for [1-(1,3-benzodioxol-5-ylsulfanyl)cyclobutyl]methanol?
The canonical SMILES for [1-(1,3-benzodioxol-5-ylsulfanyl)cyclobutyl]methanol is OCC1(Sc2ccc3c(c2)OCO3)CCC1.
What is the InChIKey of [1-(1,3-benzodioxol-5-ylsulfanyl)cyclobutyl]methanol?
The InChIKey is COSJVVRCLLSJEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O3S/c13-7-12(4-1-5-12)16-9-2-3-10-11(6-9)15-8-14-10/h2-3,6,13H,1,4-5,7-8H2.
What are the key properties of [1-(1,3-benzodioxol-5-ylsulfanyl)cyclobutyl]methanol?
[1-(1,3-benzodioxol-5-ylsulfanyl)cyclobutyl]methanol has a molecular weight of 238.31 g/mol, XLogP of 2.42, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(1,3-benzodioxol-5-ylsulfanyl)cyclobutyl]methanol is sourced from PubChem (CID 117035033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).