C10H13NO2S — CID 117032861
N-(1,3-benzodioxol-5-ylsulfanylmethyl)ethanamine (PubChem CID 117032861) has the molecular formula C10H13NO2S and a molecular weight of 211.29 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylsulfanylmethyl)ethanamine.
| Compound Name | N-(1,3-benzodioxol-5-ylsulfanylmethyl)ethanamine |
|---|---|
| PubChem CID | 117032861 |
| Molecular Formula | C10H13NO2S |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.07 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylsulfanylmethyl)ethanamine |
| SMILES | CCNCSc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C10H13NO2S/c1-2-11-6-14-8-3-4-9-10(5-8)13-7-12-9/h3-5,11H,2,6-7H2,1H3 |
| InChIKey | UZXMYJDZSJNKBY-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|