C13H19NO2 — CID 59479764
N-tert-butyl-N-ethyl-1,3-benzodioxol-5-amine (PubChem CID 59479764) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is N-tert-butyl-N-ethyl-1,3-benzodioxol-5-amine.
| Compound Name | N-tert-butyl-N-ethyl-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 59479764 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | N-tert-butyl-N-ethyl-1,3-benzodioxol-5-amine |
| SMILES | CCN(c1ccc2c(c1)OCO2)C(C)(C)C |
| InChI | InChI=1S/C13H19NO2/c1-5-14(13(2,3)4)10-6-7-11-12(8-10)16-9-15-11/h6-8H,5,9H2,1-4H3 |
| InChIKey | DCFOKXQLQWUDHG-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|