C11H16N2O2 — CID 82492500
N'-(1,3-benzodioxol-5-yl)-N,N'-dimethylethane-1,2-diamine (PubChem CID 82492500) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is N'-(1,3-benzodioxol-5-yl)-N,N'-dimethylethane-1,2-diamine.
| Compound Name | N'-(1,3-benzodioxol-5-yl)-N,N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 82492500 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | N'-(1,3-benzodioxol-5-yl)-N,N'-dimethylethane-1,2-diamine |
| SMILES | CNCCN(C)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C11H16N2O2/c1-12-5-6-13(2)9-3-4-10-11(7-9)15-8-14-10/h3-4,7,12H,5-6,8H2,1-2H3 |
| InChIKey | VUHFGDPAOHSVFG-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|