C11H14BrNO2 — CID 68690964
N-(3-bromopropyl)-N-methyl-1,3-benzodioxol-5-amine (PubChem CID 68690964) has the molecular formula C11H14BrNO2 and a molecular weight of 272.14 g/mol. Its IUPAC name is N-(3-bromopropyl)-N-methyl-1,3-benzodioxol-5-amine.
| Compound Name | N-(3-bromopropyl)-N-methyl-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 68690964 |
| Molecular Formula | C11H14BrNO2 |
| Molecular Weight | 272.14 g/mol |
| Exact Mass | 271.02 |
| IUPAC Name | N-(3-bromopropyl)-N-methyl-1,3-benzodioxol-5-amine |
| SMILES | CN(CCCBr)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C11H14BrNO2/c1-13(6-2-5-12)9-3-4-10-11(7-9)15-8-14-10/h3-4,7H,2,5-6,8H2,1H3 |
| InChIKey | BHUSSMGGEJPFCV-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.14 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|