C15H22N2O3 — CID 121230567
N-methyl-N-(3-morpholin-4-ylpropyl)-1,3-benzodioxol-5-amine (PubChem CID 121230567) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is N-methyl-N-(3-morpholin-4-ylpropyl)-1,3-benzodioxol-5-amine.
| Compound Name | N-methyl-N-(3-morpholin-4-ylpropyl)-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 121230567 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | N-methyl-N-(3-morpholin-4-ylpropyl)-1,3-benzodioxol-5-amine |
| SMILES | CN(CCCN1CCOCC1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H22N2O3/c1-16(5-2-6-17-7-9-18-10-8-17)13-3-4-14-15(11-13)20-12-19-14/h3-4,11H,2,5-10,12H2,1H3 |
| InChIKey | PENQEHPKYSVXQM-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|