C8H11NO2S — CID 142820646
1,3-benzodioxole-5-thiol;methanamine (PubChem CID 142820646) has the molecular formula C8H11NO2S and a molecular weight of 185.25 g/mol. Its IUPAC name is 1,3-benzodioxole-5-thiol;methanamine.
| Compound Name | 1,3-benzodioxole-5-thiol;methanamine |
|---|---|
| PubChem CID | 142820646 |
| Molecular Formula | C8H11NO2S |
| Molecular Weight | 185.25 g/mol |
| Exact Mass | 185.05 |
| IUPAC Name | 1,3-benzodioxole-5-thiol;methanamine |
| SMILES | CN.Sc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C7H6O2S.CH5N/c10-5-1-2-6-7(3-5)9-4-8-6;1-2/h1-3,10H,4H2;2H2,1H3 |
| InChIKey | MACYXXPABGHEFY-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.25 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|