C10H13N3O2S — CID 167039715
[6-(dimethylamino)-1,3-benzodioxol-5-yl] carbamimidothioate (PubChem CID 167039715) has the molecular formula C10H13N3O2S and a molecular weight of 239.30 g/mol. Its IUPAC name is [6-(dimethylamino)-1,3-benzodioxol-5-yl] carbamimidothioate.
| Compound Name | [6-(dimethylamino)-1,3-benzodioxol-5-yl] carbamimidothioate |
|---|---|
| PubChem CID | 167039715 |
| Molecular Formula | C10H13N3O2S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | [6-(dimethylamino)-1,3-benzodioxol-5-yl] carbamimidothioate |
| SMILES | [H]/N=C(\N)Sc1cc2c(cc1N(C)C)OCO2 |
| InChI | InChI=1S/C10H13N3O2S/c1-13(2)6-3-7-8(15-5-14-7)4-9(6)16-10(11)12/h3-4H,5H2,1-2H3,(H3,11,12) |
| InChIKey | OMKKQQZDSFAPAD-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 71.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|