C24H33N5O2S — CID 123762502
6-[[5-(2-aminoethyl)-10-ethyl-12-imino-6-methyl-2,8-diazabicyclo[5.5.0]dodeca-1(7),2,8-trien-3-yl]sulfanyl]-N,N-dimethyl-1,3-benzodioxol-5-amine (PubChem CID 123762502) has the molecular formula C24H33N5O2S and a molecular weight of 455.63 g/mol. Its IUPAC name is 6-[[5-(2-aminoethyl)-10-ethyl-12-imino-6-methyl-2,8-diazabicyclo[5.5.0]dodeca-1(7),2,8-trien-3-yl]sulfanyl]-N,N-dimethyl-1,3-benzodioxol-5-amine.
| Compound Name | 6-[[5-(2-aminoethyl)-10-ethyl-12-imino-6-methyl-2,8-diazabicyclo[5.5.0]dodeca-1(7),2,8-trien-3-yl]sulfanyl]-N,N-dimethyl-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 123762502 |
| Molecular Formula | C24H33N5O2S |
| Molecular Weight | 455.63 g/mol |
| Exact Mass | 455.24 |
| IUPAC Name | 6-[[5-(2-aminoethyl)-10-ethyl-12-imino-6-methyl-2,8-diazabicyclo[5.5.0]dodeca-1(7),2,8-trien-3-yl]sulfanyl]-N,N-dimethyl-1,3-benzodioxol-5-amine |
| SMILES | [H]/N=C1\CC(CC)C=NC2=C1N=C(Sc1cc3c(cc1N(C)C)OCO3)CC(CCN)C2C |
| InChI | InChI=1S/C24H33N5O2S/c1-5-15-8-17(26)24-23(27-12-15)14(2)16(6-7-25)9-22(28-24)32-21-11-20-19(30-13-31-20)10-18(21)29(3)4/h10-12,14-16,26H,5-9,13,25H2,1-4H3/b26-17+ |
| InChIKey | ZPQCKQNZLRIGHZ-YZSQISJMSA-N |
| XLogP | 4.71 |
| TPSA | 96.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.63 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|