C9H12N2O2S — CID 45093245
(3,6-dihydroxy-2,4-dimethylphenyl) carbamimidothioate (PubChem CID 45093245) has the molecular formula C9H12N2O2S and a molecular weight of 212.27 g/mol. Its IUPAC name is (3,6-dihydroxy-2,4-dimethylphenyl) carbamimidothioate.
| Compound Name | (3,6-dihydroxy-2,4-dimethylphenyl) carbamimidothioate |
|---|---|
| PubChem CID | 45093245 |
| Molecular Formula | C9H12N2O2S |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | (3,6-dihydroxy-2,4-dimethylphenyl) carbamimidothioate |
| SMILES | [H]/N=C(\N)Sc1c(O)cc(C)c(O)c1C |
| InChI | InChI=1S/C9H12N2O2S/c1-4-3-6(12)8(14-9(10)11)5(2)7(4)13/h3,12-13H,1-2H3,(H3,10,11) |
| InChIKey | ICDBOKIQUMUOPC-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 90.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|