C5H11N3OS — CID 65211982
(1-amino-1-oxobutan-2-yl) carbamimidothioate (PubChem CID 65211982) has the molecular formula C5H11N3OS and a molecular weight of 161.23 g/mol. Its IUPAC name is (1-amino-1-oxobutan-2-yl) carbamimidothioate.
| Compound Name | (1-amino-1-oxobutan-2-yl) carbamimidothioate |
|---|---|
| PubChem CID | 65211982 |
| Molecular Formula | C5H11N3OS |
| Molecular Weight | 161.23 g/mol |
| Exact Mass | 161.06 |
| IUPAC Name | (1-amino-1-oxobutan-2-yl) carbamimidothioate |
| SMILES | [H]/N=C(\N)SC(CC)C(N)=O |
| InChI | InChI=1S/C5H11N3OS/c1-2-3(4(6)9)10-5(7)8/h3H,2H2,1H3,(H2,6,9)(H3,7,8) |
| InChIKey | FWRVNBDPIHPYDE-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 92.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.23 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|