(4-methyl-1,1-dioxothiolan-3-yl) carbamimidothioate;sulfuric acid

C6H14N2O6S3 — CID 45048013

IUPAC(4-methyl-1,1-dioxothiolan-3-yl) carbamimidothioate;sulfuric acid
SMILESO=S(=O)(O)O.[H]/N=C(\N)SC1CS(=O)(=O)CC1C
InChIInChI=1S/C6H12N2O2S2.H2O4S/c1-4-2-12(9,10)3-5(4)11-6(7)8;1-5(2,3)4/h4-5H,2-3H2,1H3,(H3,7,8);(H2,1,2,3,4)
InChIKeyRZGXHBIHXJAUDB-UHFFFAOYSA-N
MW306.39 g/mol
LogP-0.61
Rot. Bonds1

About (4-methyl-1,1-dioxothiolan-3-yl) carbamimidothioate;sulfuric acid

(4-methyl-1,1-dioxothiolan-3-yl) carbamimidothioate;sulfuric acid (PubChem CID 45048013) has the molecular formula C6H14N2O6S3 and a molecular weight of 306.39 g/mol. Its IUPAC name is (4-methyl-1,1-dioxothiolan-3-yl) carbamimidothioate;sulfuric acid.

Molecular Properties

Compound Name(4-methyl-1,1-dioxothiolan-3-yl) carbamimidothioate;sulfuric acid
PubChem CID45048013
Molecular FormulaC6H14N2O6S3
Molecular Weight306.39 g/mol
Exact Mass306.00
IUPAC Name(4-methyl-1,1-dioxothiolan-3-yl) carbamimidothioate;sulfuric acid
SMILESO=S(=O)(O)O.[H]/N=C(\N)SC1CS(=O)(=O)CC1C
InChIInChI=1S/C6H12N2O2S2.H2O4S/c1-4-2-12(9,10)3-5(4)11-6(7)8;1-5(2,3)4/h4-5H,2-3H2,1H3,(H3,7,8);(H2,1,2,3,4)
InChIKeyRZGXHBIHXJAUDB-UHFFFAOYSA-N
XLogP-0.61
TPSA158.61 Ų
H-Bond Donors4
H-Bond Acceptors6
Rotatable Bonds1
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500306.39
LogP ≤ 5-0.61
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze (4-methyl-1,1-dioxothiolan-3-yl) carbamimidothioate;sulfuric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4-methyl-1,1-dioxothiolan-3-yl) carbamimidothioate;sulfuric acid?
The IUPAC name of (4-methyl-1,1-dioxothiolan-3-yl) carbamimidothioate;sulfuric acid (CID 45048013) is (4-methyl-1,1-dioxothiolan-3-yl) carbamimidothioate;sulfuric acid.
What is the SMILES notation for (4-methyl-1,1-dioxothiolan-3-yl) carbamimidothioate;sulfuric acid?
The canonical SMILES for (4-methyl-1,1-dioxothiolan-3-yl) carbamimidothioate;sulfuric acid is O=S(=O)(O)O.[H]/N=C(\N)SC1CS(=O)(=O)CC1C.
What is the InChIKey of (4-methyl-1,1-dioxothiolan-3-yl) carbamimidothioate;sulfuric acid?
The InChIKey is RZGXHBIHXJAUDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O2S2.H2O4S/c1-4-2-12(9,10)3-5(4)11-6(7)8;1-5(2,3)4/h4-5H,2-3H2,1H3,(H3,7,8);(H2,1,2,3,4).
What are the key properties of (4-methyl-1,1-dioxothiolan-3-yl) carbamimidothioate;sulfuric acid?
(4-methyl-1,1-dioxothiolan-3-yl) carbamimidothioate;sulfuric acid has a molecular weight of 306.39 g/mol, XLogP of -0.61, 1 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methyl-1,1-dioxothiolan-3-yl) carbamimidothioate;sulfuric acid is sourced from PubChem (CID 45048013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).