C6H14N2O6S3 — CID 45048013
(4-methyl-1,1-dioxothiolan-3-yl) carbamimidothioate;sulfuric acid (PubChem CID 45048013) has the molecular formula C6H14N2O6S3 and a molecular weight of 306.39 g/mol. Its IUPAC name is (4-methyl-1,1-dioxothiolan-3-yl) carbamimidothioate;sulfuric acid.
| Compound Name | (4-methyl-1,1-dioxothiolan-3-yl) carbamimidothioate;sulfuric acid |
|---|---|
| PubChem CID | 45048013 |
| Molecular Formula | C6H14N2O6S3 |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.00 |
| IUPAC Name | (4-methyl-1,1-dioxothiolan-3-yl) carbamimidothioate;sulfuric acid |
| SMILES | O=S(=O)(O)O.[H]/N=C(\N)SC1CS(=O)(=O)CC1C |
| InChI | InChI=1S/C6H12N2O2S2.H2O4S/c1-4-2-12(9,10)3-5(4)11-6(7)8;1-5(2,3)4/h4-5H,2-3H2,1H3,(H3,7,8);(H2,1,2,3,4) |
| InChIKey | RZGXHBIHXJAUDB-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 158.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|