C6H12O5S2 — CID 3098774
(4-methyl-1,1-dioxothiolan-3-yl) methanesulfonate (PubChem CID 3098774) has the molecular formula C6H12O5S2 and a molecular weight of 228.29 g/mol. Its IUPAC name is (4-methyl-1,1-dioxothiolan-3-yl) methanesulfonate.
| Compound Name | (4-methyl-1,1-dioxothiolan-3-yl) methanesulfonate |
|---|---|
| PubChem CID | 3098774 |
| Molecular Formula | C6H12O5S2 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.01 |
| IUPAC Name | (4-methyl-1,1-dioxothiolan-3-yl) methanesulfonate |
| SMILES | CC1CS(=O)(=O)CC1OS(C)(=O)=O |
| InChI | InChI=1S/C6H12O5S2/c1-5-3-13(9,10)4-6(5)11-12(2,7)8/h5-6H,3-4H2,1-2H3 |
| InChIKey | OMCGTFGQRJGNRB-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|