C5H8N2O2S2 — CID 51421535
[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl] carbamimidothioate (PubChem CID 51421535) has the molecular formula C5H8N2O2S2 and a molecular weight of 192.27 g/mol. Its IUPAC name is [(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl] carbamimidothioate.
| Compound Name | [(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl] carbamimidothioate |
|---|---|
| PubChem CID | 51421535 |
| Molecular Formula | C5H8N2O2S2 |
| Molecular Weight | 192.27 g/mol |
| Exact Mass | 192.00 |
| IUPAC Name | [(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl] carbamimidothioate |
| SMILES | [H]/N=C(\N)S[C@@H]1C=CS(=O)(=O)C1 |
| InChI | InChI=1S/C5H8N2O2S2/c6-5(7)10-4-1-2-11(8,9)3-4/h1-2,4H,3H2,(H3,6,7)/t4-/m1/s1 |
| InChIKey | LDDJECAYOZLNJC-SCSAIBSYSA-N |
| XLogP | -0.08 |
| TPSA | 84.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.27 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|