C6H10N2OS — CID 118493191
[(1S,2S)-2-(1-hydroxyethenyl)cyclopropyl] carbamimidothioate (PubChem CID 118493191) has the molecular formula C6H10N2OS and a molecular weight of 158.23 g/mol. Its IUPAC name is [(1S,2S)-2-(1-hydroxyethenyl)cyclopropyl] carbamimidothioate.
| Compound Name | [(1S,2S)-2-(1-hydroxyethenyl)cyclopropyl] carbamimidothioate |
|---|---|
| PubChem CID | 118493191 |
| Molecular Formula | C6H10N2OS |
| Molecular Weight | 158.23 g/mol |
| Exact Mass | 158.05 |
| IUPAC Name | [(1S,2S)-2-(1-hydroxyethenyl)cyclopropyl] carbamimidothioate |
| SMILES | [H]/N=C(\N)S[C@H]1C[C@H]1C(=C)O |
| InChI | InChI=1S/C6H10N2OS/c1-3(9)4-2-5(4)10-6(7)8/h4-5,9H,1-2H2,(H3,7,8)/t4-,5-/m0/s1 |
| InChIKey | ACMKRSKGNKHXGY-WHFBIAKZSA-N |
| XLogP | 1.07 |
| TPSA | 70.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.23 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|