About cyclohexyl carbamimidothioate;hydrobromide
cyclohexyl carbamimidothioate;hydrobromide (PubChem CID 13257205) has the molecular formula C7H15BrN2S
and a molecular weight of 239.18 g/mol. Its IUPAC name is cyclohexyl carbamimidothioate;hydrobromide.
Molecular Properties
| Compound Name | cyclohexyl carbamimidothioate;hydrobromide |
| PubChem CID | 13257205 |
| Molecular Formula | C7H15BrN2S |
| Molecular Weight | 239.18 g/mol |
| Exact Mass | 238.01 |
| IUPAC Name | cyclohexyl carbamimidothioate;hydrobromide |
| SMILES | Br.[H]/N=C(\N)SC1CCCCC1 |
| InChI | InChI=1S/C7H14N2S.BrH/c8-7(9)10-6-4-2-1-3-5-6;/h6H,1-5H2,(H3,8,9);1H |
| InChIKey | AWSWDTIGGJNUMP-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.18 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze cyclohexyl carbamimidothioate;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl carbamimidothioate;hydrobromide?
The IUPAC name of cyclohexyl carbamimidothioate;hydrobromide (CID 13257205) is cyclohexyl carbamimidothioate;hydrobromide.
What is the SMILES notation for cyclohexyl carbamimidothioate;hydrobromide?
The canonical SMILES for cyclohexyl carbamimidothioate;hydrobromide is Br.[H]/N=C(\N)SC1CCCCC1.
What is the InChIKey of cyclohexyl carbamimidothioate;hydrobromide?
The InChIKey is AWSWDTIGGJNUMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2S.BrH/c8-7(9)10-6-4-2-1-3-5-6;/h6H,1-5H2,(H3,8,9);1H.
What are the key properties of cyclohexyl carbamimidothioate;hydrobromide?
cyclohexyl carbamimidothioate;hydrobromide has a molecular weight of 239.18 g/mol, XLogP of 2.52, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl carbamimidothioate;hydrobromide is sourced from PubChem (CID 13257205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).