About CID 168867321
CID 168867321 (PubChem CID 168867321) has the molecular formula C7H14N2Si
and a molecular weight of 154.29 g/mol.
Molecular Properties
| Compound Name | CID 168867321 |
| PubChem CID | 168867321 |
| Molecular Formula | C7H14N2Si |
| Molecular Weight | 154.29 g/mol |
| Exact Mass | 154.09 |
| IUPAC Name | — |
| SMILES | [H]/N=C(\N)[Si]C1CCCCC1 |
| InChI | InChI=1S/C7H14N2Si/c8-7(9)10-6-4-2-1-3-5-6/h6H,1-5H2,(H3,8,9) |
| InChIKey | RLJLUNKDYPCGMN-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.29 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze CID 168867321 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 168867321?
The IUPAC name of CID 168867321 (CID 168867321) is not available.
What is the SMILES notation for CID 168867321?
The canonical SMILES for CID 168867321 is [H]/N=C(\N)[Si]C1CCCCC1.
What is the InChIKey of CID 168867321?
The InChIKey is RLJLUNKDYPCGMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2Si/c8-7(9)10-6-4-2-1-3-5-6/h6H,1-5H2,(H3,8,9).
What are the key properties of CID 168867321?
CID 168867321 has a molecular weight of 154.29 g/mol, XLogP of 1.34, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 168867321 is sourced from PubChem (CID 168867321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).