About [hydroxy-(imino-λ4-sulfanylidene)methyl] carbamimidothioate
[hydroxy-(imino-λ4-sulfanylidene)methyl] carbamimidothioate (PubChem CID 150828738) has the molecular formula C2H5N3OS2
and a molecular weight of 151.22 g/mol. Its IUPAC name is [hydroxy-(imino-λ4-sulfanylidene)methyl] carbamimidothioate.
Molecular Properties
| Compound Name | [hydroxy-(imino-λ4-sulfanylidene)methyl] carbamimidothioate |
| PubChem CID | 150828738 |
| Molecular Formula | C2H5N3OS2 |
| Molecular Weight | 151.22 g/mol |
| Exact Mass | 150.99 |
| IUPAC Name | [hydroxy-(imino-λ4-sulfanylidene)methyl] carbamimidothioate |
| SMILES | [H]/N=C(\N)SC(O)=S=N |
| InChI | InChI=1S/C2H5N3OS2/c3-1(4)7-2(6)8-5/h5-6H,(H3,3,4) |
| InChIKey | KLMNQEPSEHRITG-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.22 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [hydroxy-(imino-λ4-sulfanylidene)methyl] carbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [hydroxy-(imino-λ4-sulfanylidene)methyl] carbamimidothioate?
The IUPAC name of [hydroxy-(imino-λ4-sulfanylidene)methyl] carbamimidothioate (CID 150828738) is [hydroxy-(imino-λ4-sulfanylidene)methyl] carbamimidothioate.
What is the SMILES notation for [hydroxy-(imino-λ4-sulfanylidene)methyl] carbamimidothioate?
The canonical SMILES for [hydroxy-(imino-λ4-sulfanylidene)methyl] carbamimidothioate is [H]/N=C(\N)SC(O)=S=N.
What is the InChIKey of [hydroxy-(imino-λ4-sulfanylidene)methyl] carbamimidothioate?
The InChIKey is KLMNQEPSEHRITG-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5N3OS2/c3-1(4)7-2(6)8-5/h5-6H,(H3,3,4).
What are the key properties of [hydroxy-(imino-λ4-sulfanylidene)methyl] carbamimidothioate?
[hydroxy-(imino-λ4-sulfanylidene)methyl] carbamimidothioate has a molecular weight of 151.22 g/mol, XLogP of 0.10, 0 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [hydroxy-(imino-λ4-sulfanylidene)methyl] carbamimidothioate is sourced from PubChem (CID 150828738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).