C5H10N2O2S — CID 61057340
1,1-dioxothiolane-3-carboximidamide (PubChem CID 61057340) has the molecular formula C5H10N2O2S and a molecular weight of 162.21 g/mol. Its IUPAC name is 1,1-dioxothiolane-3-carboximidamide.
| Compound Name | 1,1-dioxothiolane-3-carboximidamide |
|---|---|
| PubChem CID | 61057340 |
| Molecular Formula | C5H10N2O2S |
| Molecular Weight | 162.21 g/mol |
| Exact Mass | 162.05 |
| IUPAC Name | 1,1-dioxothiolane-3-carboximidamide |
| SMILES | [H]/N=C(\N)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C5H10N2O2S/c6-5(7)4-1-2-10(8,9)3-4/h4H,1-3H2,(H3,6,7) |
| InChIKey | MHSIMOIQHWRGNR-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 84.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.21 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|