C9H18N2O2S — CID 115337478
N'-tert-butyl-1,1-dioxothiolane-3-carboximidamide (PubChem CID 115337478) has the molecular formula C9H18N2O2S and a molecular weight of 218.32 g/mol. Its IUPAC name is N'-tert-butyl-1,1-dioxothiolane-3-carboximidamide.
| Compound Name | N'-tert-butyl-1,1-dioxothiolane-3-carboximidamide |
|---|---|
| PubChem CID | 115337478 |
| Molecular Formula | C9H18N2O2S |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | N'-tert-butyl-1,1-dioxothiolane-3-carboximidamide |
| SMILES | CC(C)(C)/N=C(\N)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H18N2O2S/c1-9(2,3)11-8(10)7-4-5-14(12,13)6-7/h7H,4-6H2,1-3H3,(H2,10,11) |
| InChIKey | XPSZELPEHHGIMF-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|