C7H13FN2O2S — CID 115025790
2-(1,1-dioxothian-3-yl)-2-fluoroethanimidamide (PubChem CID 115025790) has the molecular formula C7H13FN2O2S and a molecular weight of 208.26 g/mol. Its IUPAC name is 2-(1,1-dioxothian-3-yl)-2-fluoroethanimidamide.
| Compound Name | 2-(1,1-dioxothian-3-yl)-2-fluoroethanimidamide |
|---|---|
| PubChem CID | 115025790 |
| Molecular Formula | C7H13FN2O2S |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 2-(1,1-dioxothian-3-yl)-2-fluoroethanimidamide |
| SMILES | [H]/N=C(\N)C(F)C1CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C7H13FN2O2S/c8-6(7(9)10)5-2-1-3-13(11,12)4-5/h5-6H,1-4H2,(H3,9,10) |
| InChIKey | CTWGPFKSCRGOKE-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 84.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|