C10H21NO2S — CID 79299591
1-(1,1-dioxothian-3-yl)-N,2-dimethylpropan-1-amine (PubChem CID 79299591) has the molecular formula C10H21NO2S and a molecular weight of 219.35 g/mol. Its IUPAC name is 1-(1,1-dioxothian-3-yl)-N,2-dimethylpropan-1-amine.
| Compound Name | 1-(1,1-dioxothian-3-yl)-N,2-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 79299591 |
| Molecular Formula | C10H21NO2S |
| Molecular Weight | 219.35 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 1-(1,1-dioxothian-3-yl)-N,2-dimethylpropan-1-amine |
| SMILES | CNC(C(C)C)C1CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H21NO2S/c1-8(2)10(11-3)9-5-4-6-14(12,13)7-9/h8-11H,4-7H2,1-3H3 |
| InChIKey | XVIHNQCSKNOBHC-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.35 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |