C14H21NO2S — CID 115049800
[2-[1-(1,1-dioxothian-3-yl)ethyl]phenyl]methanamine (PubChem CID 115049800) has the molecular formula C14H21NO2S and a molecular weight of 267.39 g/mol. Its IUPAC name is [2-[1-(1,1-dioxothian-3-yl)ethyl]phenyl]methanamine.
| Compound Name | [2-[1-(1,1-dioxothian-3-yl)ethyl]phenyl]methanamine |
|---|---|
| PubChem CID | 115049800 |
| Molecular Formula | C14H21NO2S |
| Molecular Weight | 267.39 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | [2-[1-(1,1-dioxothian-3-yl)ethyl]phenyl]methanamine |
| SMILES | CC(c1ccccc1CN)C1CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H21NO2S/c1-11(13-6-4-8-18(16,17)10-13)14-7-3-2-5-12(14)9-15/h2-3,5,7,11,13H,4,6,8-10,15H2,1H3 |
| InChIKey | LQDVLKZEFFMCPF-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.39 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |