C13H18FN — CID 115025382
[2-[cyclopentyl(fluoro)methyl]phenyl]methanamine (PubChem CID 115025382) has the molecular formula C13H18FN and a molecular weight of 207.29 g/mol. Its IUPAC name is [2-[cyclopentyl(fluoro)methyl]phenyl]methanamine.
| Compound Name | [2-[cyclopentyl(fluoro)methyl]phenyl]methanamine |
|---|---|
| PubChem CID | 115025382 |
| Molecular Formula | C13H18FN |
| Molecular Weight | 207.29 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | [2-[cyclopentyl(fluoro)methyl]phenyl]methanamine |
| SMILES | NCc1ccccc1C(F)C1CCCC1 |
| InChI | InChI=1S/C13H18FN/c14-13(10-5-1-2-6-10)12-8-4-3-7-11(12)9-15/h3-4,7-8,10,13H,1-2,5-6,9,15H2 |
| InChIKey | HKITXNMLGLBPIB-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.29 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |