C13H16F2O — CID 115035529
[2-(1-cyclobutyl-2,2-difluoroethyl)phenyl]methanol (PubChem CID 115035529) has the molecular formula C13H16F2O and a molecular weight of 226.27 g/mol. Its IUPAC name is [2-(1-cyclobutyl-2,2-difluoroethyl)phenyl]methanol.
| Compound Name | [2-(1-cyclobutyl-2,2-difluoroethyl)phenyl]methanol |
|---|---|
| PubChem CID | 115035529 |
| Molecular Formula | C13H16F2O |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | [2-(1-cyclobutyl-2,2-difluoroethyl)phenyl]methanol |
| SMILES | OCc1ccccc1C(C(F)F)C1CCC1 |
| InChI | InChI=1S/C13H16F2O/c14-13(15)12(9-5-3-6-9)11-7-2-1-4-10(11)8-16/h1-2,4,7,9,12-13,16H,3,5-6,8H2 |
| InChIKey | UGLMQQCSHBQWPJ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |