C14H18O3S — CID 115049571
2-[1-(1,1-dioxothian-3-yl)ethyl]benzaldehyde (PubChem CID 115049571) has the molecular formula C14H18O3S and a molecular weight of 266.36 g/mol. Its IUPAC name is 2-[1-(1,1-dioxothian-3-yl)ethyl]benzaldehyde.
| Compound Name | 2-[1-(1,1-dioxothian-3-yl)ethyl]benzaldehyde |
|---|---|
| PubChem CID | 115049571 |
| Molecular Formula | C14H18O3S |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | 2-[1-(1,1-dioxothian-3-yl)ethyl]benzaldehyde |
| SMILES | CC(c1ccccc1C=O)C1CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H18O3S/c1-11(13-6-4-8-18(16,17)10-13)14-7-3-2-5-12(14)9-15/h2-3,5,7,9,11,13H,4,6,8,10H2,1H3 |
| InChIKey | KHVHRVMTDRPNJO-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|