C9H15NO2S3 — CID 3699587
(1,1-dioxo-2,3-dihydrothiophen-3-yl) N,N-diethylcarbamodithioate (PubChem CID 3699587) has the molecular formula C9H15NO2S3 and a molecular weight of 265.42 g/mol. Its IUPAC name is (1,1-dioxo-2,3-dihydrothiophen-3-yl) N,N-diethylcarbamodithioate.
| Compound Name | (1,1-dioxo-2,3-dihydrothiophen-3-yl) N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 3699587 |
| Molecular Formula | C9H15NO2S3 |
| Molecular Weight | 265.42 g/mol |
| Exact Mass | 265.03 |
| IUPAC Name | (1,1-dioxo-2,3-dihydrothiophen-3-yl) N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)SC1C=CS(=O)(=O)C1 |
| InChI | InChI=1S/C9H15NO2S3/c1-3-10(4-2)9(13)14-8-5-6-15(11,12)7-8/h5-6,8H,3-4,7H2,1-2H3 |
| InChIKey | SIOMLFZWZFMYBL-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.42 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|