C11H19NOS2 — CID 11586818
(3-oxocyclohexyl) N,N-diethylcarbamodithioate (PubChem CID 11586818) has the molecular formula C11H19NOS2 and a molecular weight of 245.41 g/mol. Its IUPAC name is (3-oxocyclohexyl) N,N-diethylcarbamodithioate.
| Compound Name | (3-oxocyclohexyl) N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 11586818 |
| Molecular Formula | C11H19NOS2 |
| Molecular Weight | 245.41 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | (3-oxocyclohexyl) N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)SC1CCCC(=O)C1 |
| InChI | InChI=1S/C11H19NOS2/c1-3-12(4-2)11(14)15-10-7-5-6-9(13)8-10/h10H,3-8H2,1-2H3 |
| InChIKey | GSUHHEYJTICJJX-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.41 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|