C18H26N2OS2 — CID 102072685
(1-benzyl-2-oxoazepan-4-yl) N,N-diethylcarbamodithioate (PubChem CID 102072685) has the molecular formula C18H26N2OS2 and a molecular weight of 350.55 g/mol. Its IUPAC name is (1-benzyl-2-oxoazepan-4-yl) N,N-diethylcarbamodithioate.
| Compound Name | (1-benzyl-2-oxoazepan-4-yl) N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 102072685 |
| Molecular Formula | C18H26N2OS2 |
| Molecular Weight | 350.55 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | (1-benzyl-2-oxoazepan-4-yl) N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)SC1CCCN(Cc2ccccc2)C(=O)C1 |
| InChI | InChI=1S/C18H26N2OS2/c1-3-19(4-2)18(22)23-16-11-8-12-20(17(21)13-16)14-15-9-6-5-7-10-15/h5-7,9-10,16H,3-4,8,11-14H2,1-2H3 |
| InChIKey | GDCYHGAHLAYAPK-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.55 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|