C10H16BrNO2S3 — CID 3835435
(5-bromo-4-methyl-1,1-dioxo-2,3-dihydrothiophen-3-yl) N,N-diethylcarbamodithioate (PubChem CID 3835435) has the molecular formula C10H16BrNO2S3 and a molecular weight of 358.35 g/mol. Its IUPAC name is (5-bromo-4-methyl-1,1-dioxo-2,3-dihydrothiophen-3-yl) N,N-diethylcarbamodithioate.
| Compound Name | (5-bromo-4-methyl-1,1-dioxo-2,3-dihydrothiophen-3-yl) N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 3835435 |
| Molecular Formula | C10H16BrNO2S3 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 356.95 |
| IUPAC Name | (5-bromo-4-methyl-1,1-dioxo-2,3-dihydrothiophen-3-yl) N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)SC1CS(=O)(=O)C(Br)=C1C |
| InChI | InChI=1S/C10H16BrNO2S3/c1-4-12(5-2)10(15)16-8-6-17(13,14)9(11)7(8)3/h8H,4-6H2,1-3H3 |
| InChIKey | AOBZZWXFGXRCGB-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|