C6H10N3O3S2+ — CID 135460908
[amino-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)sulfanyl]methylidene]-formamidoazanium (PubChem CID 135460908) has the molecular formula C6H10N3O3S2+ and a molecular weight of 236.30 g/mol. Its IUPAC name is [amino-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)sulfanyl]methylidene]-formamidoazanium.
| Compound Name | [amino-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)sulfanyl]methylidene]-formamidoazanium |
|---|---|
| PubChem CID | 135460908 |
| Molecular Formula | C6H10N3O3S2+ |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.02 |
| IUPAC Name | [amino-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)sulfanyl]methylidene]-formamidoazanium |
| SMILES | NC(=[NH+]NC=O)SC1C=CS(=O)(=O)C1 |
| InChI | InChI=1S/C6H9N3O3S2/c7-6(9-8-4-10)13-5-1-2-14(11,12)3-5/h1-2,4-5H,3H2,(H2,7,9)(H,8,10)/p+1 |
| InChIKey | IMZSMYZVYUHWAB-UHFFFAOYSA-O |
| XLogP | -2.91 |
| TPSA | 103.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | -2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|