C8H12ClNO2S — CID 81429423
N-[(E)-4-chlorobut-2-enyl]-1,1-dioxo-2,3-dihydrothiophen-3-amine (PubChem CID 81429423) has the molecular formula C8H12ClNO2S and a molecular weight of 221.71 g/mol. Its IUPAC name is N-[(E)-4-chlorobut-2-enyl]-1,1-dioxo-2,3-dihydrothiophen-3-amine.
| Compound Name | N-[(E)-4-chlorobut-2-enyl]-1,1-dioxo-2,3-dihydrothiophen-3-amine |
|---|---|
| PubChem CID | 81429423 |
| Molecular Formula | C8H12ClNO2S |
| Molecular Weight | 221.71 g/mol |
| Exact Mass | 221.03 |
| IUPAC Name | N-[(E)-4-chlorobut-2-enyl]-1,1-dioxo-2,3-dihydrothiophen-3-amine |
| SMILES | O=S1(=O)C=CC(NC/C=C/CCl)C1 |
| InChI | InChI=1S/C8H12ClNO2S/c9-4-1-2-5-10-8-3-6-13(11,12)7-8/h1-3,6,8,10H,4-5,7H2/b2-1+ |
| InChIKey | BBDGTPCRYCXHHI-OWOJBTEDSA-N |
| XLogP | 0.68 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.71 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|