C6H15NO5P2S — CID 87475526
[cyclohexyl(dihydroxyphosphinothioyl)amino]phosphonic acid (PubChem CID 87475526) has the molecular formula C6H15NO5P2S and a molecular weight of 275.20 g/mol. Its IUPAC name is [cyclohexyl(dihydroxyphosphinothioyl)amino]phosphonic acid.
| Compound Name | [cyclohexyl(dihydroxyphosphinothioyl)amino]phosphonic acid |
|---|---|
| PubChem CID | 87475526 |
| Molecular Formula | C6H15NO5P2S |
| Molecular Weight | 275.20 g/mol |
| Exact Mass | 275.01 |
| IUPAC Name | [cyclohexyl(dihydroxyphosphinothioyl)amino]phosphonic acid |
| SMILES | O=P(O)(O)N(C1CCCCC1)P(O)(O)=S |
| InChI | InChI=1S/C6H15NO5P2S/c8-13(9,10)7(14(11,12)15)6-4-2-1-3-5-6/h6H,1-5H2,(H2,8,9,10)(H2,11,12,15) |
| InChIKey | AVRKKMNXMRQVOW-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 101.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.20 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|