C7H18NO6P2+ — CID 5276559
[(2-methylpiperidin-1-ium-1-yl)-phosphonomethyl]phosphonic acid (PubChem CID 5276559) has the molecular formula C7H18NO6P2+ and a molecular weight of 274.17 g/mol. Its IUPAC name is [(2-methylpiperidin-1-ium-1-yl)-phosphonomethyl]phosphonic acid.
| Compound Name | [(2-methylpiperidin-1-ium-1-yl)-phosphonomethyl]phosphonic acid |
|---|---|
| PubChem CID | 5276559 |
| Molecular Formula | C7H18NO6P2+ |
| Molecular Weight | 274.17 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | [(2-methylpiperidin-1-ium-1-yl)-phosphonomethyl]phosphonic acid |
| SMILES | CC1CCCC[NH+]1C(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C7H17NO6P2/c1-6-4-2-3-5-8(6)7(15(9,10)11)16(12,13)14/h6-7H,2-5H2,1H3,(H2,9,10,11)(H2,12,13,14)/p+1 |
| InChIKey | OHWRHQKXXJLTSO-UHFFFAOYSA-O |
| XLogP | -0.92 |
| TPSA | 119.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.17 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|