C20H24N2O5S — CID 87481575
3-[6-[3-ethyl-4-[methyl-[[(2S)-oxiran-2-yl]methyl]sulfamoyl]phenyl]-2-pyridinyl]propanoic acid (PubChem CID 87481575) has the molecular formula C20H24N2O5S and a molecular weight of 404.49 g/mol. Its IUPAC name is 3-[6-[3-ethyl-4-[methyl-[[(2S)-oxiran-2-yl]methyl]sulfamoyl]phenyl]-2-pyridinyl]propanoic acid.
| Compound Name | 3-[6-[3-ethyl-4-[methyl-[[(2S)-oxiran-2-yl]methyl]sulfamoyl]phenyl]-2-pyridinyl]propanoic acid |
|---|---|
| PubChem CID | 87481575 |
| Molecular Formula | C20H24N2O5S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | 3-[6-[3-ethyl-4-[methyl-[[(2S)-oxiran-2-yl]methyl]sulfamoyl]phenyl]-2-pyridinyl]propanoic acid |
| SMILES | CCc1cc(-c2cccc(CCC(=O)O)n2)ccc1S(=O)(=O)N(C)C[C@H]1CO1 |
| InChI | InChI=1S/C20H24N2O5S/c1-3-14-11-15(18-6-4-5-16(21-18)8-10-20(23)24)7-9-19(14)28(25,26)22(2)12-17-13-27-17/h4-7,9,11,17H,3,8,10,12-13H2,1-2H3,(H,23,24)/t17-/m0/s1 |
| InChIKey | GKJZJAHCZFJILG-KRWDZBQOSA-N |
| XLogP | 2.35 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|