C26H18Cl6N2O2S — CID 87483345
4-[4-[4-[4-amino-3-(trichloromethyl)phenoxy]phenyl]sulfanylphenoxy]-2-(trichloromethyl)aniline (PubChem CID 87483345) has the molecular formula C26H18Cl6N2O2S and a molecular weight of 635.23 g/mol. Its IUPAC name is 4-[4-[4-[4-amino-3-(trichloromethyl)phenoxy]phenyl]sulfanylphenoxy]-2-(trichloromethyl)aniline.
| Compound Name | 4-[4-[4-[4-amino-3-(trichloromethyl)phenoxy]phenyl]sulfanylphenoxy]-2-(trichloromethyl)aniline |
|---|---|
| PubChem CID | 87483345 |
| Molecular Formula | C26H18Cl6N2O2S |
| Molecular Weight | 635.23 g/mol |
| Exact Mass | 631.92 |
| IUPAC Name | 4-[4-[4-[4-amino-3-(trichloromethyl)phenoxy]phenyl]sulfanylphenoxy]-2-(trichloromethyl)aniline |
| SMILES | Nc1ccc(Oc2ccc(Sc3ccc(Oc4ccc(N)c(C(Cl)(Cl)Cl)c4)cc3)cc2)cc1C(Cl)(Cl)Cl |
| InChI | InChI=1S/C26H18Cl6N2O2S/c27-25(28,29)21-13-17(5-11-23(21)33)35-15-1-7-19(8-2-15)37-20-9-3-16(4-10-20)36-18-6-12-24(34)22(14-18)26(30,31)32/h1-14H,33-34H2 |
| InChIKey | GLBOOVVBSMBXGO-UHFFFAOYSA-N |
| XLogP | 10.24 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.23 |
| LogP ≤ 5 | 10.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|