C26H18Cl6N2O4S — CID 87439033
4-[4-[4-[4-amino-3-(trichloromethyl)phenoxy]phenyl]sulfonylphenoxy]-2-(trichloromethyl)aniline (PubChem CID 87439033) has the molecular formula C26H18Cl6N2O4S and a molecular weight of 667.23 g/mol. Its IUPAC name is 4-[4-[4-[4-amino-3-(trichloromethyl)phenoxy]phenyl]sulfonylphenoxy]-2-(trichloromethyl)aniline.
| Compound Name | 4-[4-[4-[4-amino-3-(trichloromethyl)phenoxy]phenyl]sulfonylphenoxy]-2-(trichloromethyl)aniline |
|---|---|
| PubChem CID | 87439033 |
| Molecular Formula | C26H18Cl6N2O4S |
| Molecular Weight | 667.23 g/mol |
| Exact Mass | 663.91 |
| IUPAC Name | 4-[4-[4-[4-amino-3-(trichloromethyl)phenoxy]phenyl]sulfonylphenoxy]-2-(trichloromethyl)aniline |
| SMILES | Nc1ccc(Oc2ccc(S(=O)(=O)c3ccc(Oc4ccc(N)c(C(Cl)(Cl)Cl)c4)cc3)cc2)cc1C(Cl)(Cl)Cl |
| InChI | InChI=1S/C26H18Cl6N2O4S/c27-25(28,29)21-13-17(5-11-23(21)33)37-15-1-7-19(8-2-15)39(35,36)20-9-3-16(4-10-20)38-18-6-12-24(34)22(14-18)26(30,31)32/h1-14H,33-34H2 |
| InChIKey | XCFDGDVKLMAZRQ-UHFFFAOYSA-N |
| XLogP | 8.92 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.23 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|