C16H14F6N6O2 — CID 87490561
N-ethyl-N-[5-nitro-2-(trifluoromethyl)-4-pyridinyl]-7-(trifluoromethyl)-1,2,3,4-tetrahydropyrido[3,4-b]pyrazin-3-amine (PubChem CID 87490561) has the molecular formula C16H14F6N6O2 and a molecular weight of 436.32 g/mol. Its IUPAC name is N-ethyl-N-[5-nitro-2-(trifluoromethyl)-4-pyridinyl]-7-(trifluoromethyl)-1,2,3,4-tetrahydropyrido[3,4-b]pyrazin-3-amine.
| Compound Name | N-ethyl-N-[5-nitro-2-(trifluoromethyl)-4-pyridinyl]-7-(trifluoromethyl)-1,2,3,4-tetrahydropyrido[3,4-b]pyrazin-3-amine |
|---|---|
| PubChem CID | 87490561 |
| Molecular Formula | C16H14F6N6O2 |
| Molecular Weight | 436.32 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | N-ethyl-N-[5-nitro-2-(trifluoromethyl)-4-pyridinyl]-7-(trifluoromethyl)-1,2,3,4-tetrahydropyrido[3,4-b]pyrazin-3-amine |
| SMILES | CCN(c1cc(C(F)(F)F)ncc1[N+](=O)[O-])C1CNc2cc(C(F)(F)F)ncc2N1 |
| InChI | InChI=1S/C16H14F6N6O2/c1-2-27(10-4-13(16(20,21)22)25-6-11(10)28(29)30)14-7-23-8-3-12(15(17,18)19)24-5-9(8)26-14/h3-6,14,23,26H,2,7H2,1H3 |
| InChIKey | GPRAUSFEIIUFNX-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.32 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|