About cyclohexa-2,4-diene-1-carboxamide;1-methylimidazole-2-carbaldehyde
cyclohexa-2,4-diene-1-carboxamide;1-methylimidazole-2-carbaldehyde (PubChem CID 87490692) has the molecular formula C12H15N3O2
and a molecular weight of 233.27 g/mol. Its IUPAC name is cyclohexa-2,4-diene-1-carboxamide;1-methylimidazole-2-carbaldehyde.
Molecular Properties
| Compound Name | cyclohexa-2,4-diene-1-carboxamide;1-methylimidazole-2-carbaldehyde |
| PubChem CID | 87490692 |
| Molecular Formula | C12H15N3O2 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | cyclohexa-2,4-diene-1-carboxamide;1-methylimidazole-2-carbaldehyde |
| SMILES | Cn1ccnc1C=O.NC(=O)C1C=CC=CC1 |
| InChI | InChI=1S/C7H9NO.C5H6N2O/c8-7(9)6-4-2-1-3-5-6;1-7-3-2-6-5(7)4-8/h1-4,6H,5H2,(H2,8,9);2-4H,1H3 |
| InChIKey | RWNFLMXDOCABQC-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze cyclohexa-2,4-diene-1-carboxamide;1-methylimidazole-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexa-2,4-diene-1-carboxamide;1-methylimidazole-2-carbaldehyde?
The IUPAC name of cyclohexa-2,4-diene-1-carboxamide;1-methylimidazole-2-carbaldehyde (CID 87490692) is cyclohexa-2,4-diene-1-carboxamide;1-methylimidazole-2-carbaldehyde.
What is the SMILES notation for cyclohexa-2,4-diene-1-carboxamide;1-methylimidazole-2-carbaldehyde?
The canonical SMILES for cyclohexa-2,4-diene-1-carboxamide;1-methylimidazole-2-carbaldehyde is Cn1ccnc1C=O.NC(=O)C1C=CC=CC1.
What is the InChIKey of cyclohexa-2,4-diene-1-carboxamide;1-methylimidazole-2-carbaldehyde?
The InChIKey is RWNFLMXDOCABQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO.C5H6N2O/c8-7(9)6-4-2-1-3-5-6;1-7-3-2-6-5(7)4-8/h1-4,6H,5H2,(H2,8,9);2-4H,1H3.
What are the key properties of cyclohexa-2,4-diene-1-carboxamide;1-methylimidazole-2-carbaldehyde?
cyclohexa-2,4-diene-1-carboxamide;1-methylimidazole-2-carbaldehyde has a molecular weight of 233.27 g/mol, XLogP of 0.84, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexa-2,4-diene-1-carboxamide;1-methylimidazole-2-carbaldehyde is sourced from PubChem (CID 87490692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).