C8H17N3O3 — CID 87493983
3-aminopropanoic acid;2-(prop-2-enylamino)acetamide (PubChem CID 87493983) has the molecular formula C8H17N3O3 and a molecular weight of 203.24 g/mol. Its IUPAC name is 3-aminopropanoic acid;2-(prop-2-enylamino)acetamide.
| Compound Name | 3-aminopropanoic acid;2-(prop-2-enylamino)acetamide |
|---|---|
| PubChem CID | 87493983 |
| Molecular Formula | C8H17N3O3 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 3-aminopropanoic acid;2-(prop-2-enylamino)acetamide |
| SMILES | C=CCNCC(N)=O.NCCC(=O)O |
| InChI | InChI=1S/C5H10N2O.C3H7NO2/c1-2-3-7-4-5(6)8;4-2-1-3(5)6/h2,7H,1,3-4H2,(H2,6,8);1-2,4H2,(H,5,6) |
| InChIKey | MQTFETRKSJDRGU-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 118.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|