C23H26N2 — CID 87493998
N-[[1-phenyl-2-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)ethylidene]amino]aniline (PubChem CID 87493998) has the molecular formula C23H26N2 and a molecular weight of 330.48 g/mol. Its IUPAC name is N-[[1-phenyl-2-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)ethylidene]amino]aniline.
| Compound Name | N-[[1-phenyl-2-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)ethylidene]amino]aniline |
|---|---|
| PubChem CID | 87493998 |
| Molecular Formula | C23H26N2 |
| Molecular Weight | 330.48 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | N-[[1-phenyl-2-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)ethylidene]amino]aniline |
| SMILES | CC1=C(C)C(C)C(CC(=NNc2ccccc2)c2ccccc2)=C1C |
| InChI | InChI=1S/C23H26N2/c1-16-17(2)19(4)22(18(16)3)15-23(20-11-7-5-8-12-20)25-24-21-13-9-6-10-14-21/h5-14,18,24H,15H2,1-4H3 |
| InChIKey | OKPNQHGJLMMHHR-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.48 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|