C35H29N — CID 87494464
[3-(2-phenyl-1H-inden-1-yl)-1-(2,3,4-trimethylphenyl)naphthalen-2-yl]methanimine (PubChem CID 87494464) has the molecular formula C35H29N and a molecular weight of 463.62 g/mol. Its IUPAC name is [3-(2-phenyl-1H-inden-1-yl)-1-(2,3,4-trimethylphenyl)naphthalen-2-yl]methanimine.
| Compound Name | [3-(2-phenyl-1H-inden-1-yl)-1-(2,3,4-trimethylphenyl)naphthalen-2-yl]methanimine |
|---|---|
| PubChem CID | 87494464 |
| Molecular Formula | C35H29N |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.23 |
| IUPAC Name | [3-(2-phenyl-1H-inden-1-yl)-1-(2,3,4-trimethylphenyl)naphthalen-2-yl]methanimine |
| SMILES | [H]/N=C/c1c(C2C(c3ccccc3)=Cc3ccccc32)cc2ccccc2c1-c1ccc(C)c(C)c1C |
| InChI | InChI=1S/C35H29N/c1-22-17-18-28(24(3)23(22)2)34-29-15-9-8-14-27(29)20-32(33(34)21-36)35-30-16-10-7-13-26(30)19-31(35)25-11-5-4-6-12-25/h4-21,35-36H,1-3H3/b36-21+ |
| InChIKey | WIWWEPGSOGUQTQ-QLQYKETESA-N |
| XLogP | 9.12 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|