C30H23N — CID 146369049
[1-[2-methyl-4-(3-phenylphenyl)phenyl]naphthalen-2-yl]methanimine (PubChem CID 146369049) has the molecular formula C30H23N and a molecular weight of 397.52 g/mol. Its IUPAC name is [1-[2-methyl-4-(3-phenylphenyl)phenyl]naphthalen-2-yl]methanimine.
| Compound Name | [1-[2-methyl-4-(3-phenylphenyl)phenyl]naphthalen-2-yl]methanimine |
|---|---|
| PubChem CID | 146369049 |
| Molecular Formula | C30H23N |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | [1-[2-methyl-4-(3-phenylphenyl)phenyl]naphthalen-2-yl]methanimine |
| SMILES | [H]/N=C/c1ccc2ccccc2c1-c1ccc(-c2cccc(-c3ccccc3)c2)cc1C |
| InChI | InChI=1S/C30H23N/c1-21-18-26(25-12-7-11-24(19-25)22-8-3-2-4-9-22)16-17-28(21)30-27(20-31)15-14-23-10-5-6-13-29(23)30/h2-20,31H,1H3/b31-20+ |
| InChIKey | TWECIOLWDLSWHM-AJBULDERSA-N |
| XLogP | 8.15 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|